CymitQuimica logo

CAS 1354017-83-6

:

N-[(3S)-1-(2-Aminoacetyl)-3-piperidinyl]-N-(1-methylethyl)acetamide

Description:
N-[(3S)-1-(2-Aminoacetyl)-3-piperidinyl]-N-(1-methylethyl)acetamide, with the CAS number 1354017-83-6, is a chemical compound characterized by its specific structural features, including a piperidine ring and an acetamide functional group. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry, where it may serve as a pharmacological agent. The presence of the aminoacetyl group suggests that it may interact with biological systems, potentially influencing various physiological processes. Its stereochemistry, indicated by the (3S) designation, implies that it has a specific three-dimensional arrangement that can affect its biological interactions and efficacy. The compound's solubility, stability, and reactivity are influenced by its functional groups and molecular structure, making it a subject of interest for further research in drug development and therapeutic applications. Overall, this compound exemplifies the complexity and diversity of chemical substances used in pharmaceutical research.
Formula:C12H23N3O2
InChI:InChI=1S/C12H23N3O2/c1-9(2)15(10(3)16)11-5-4-6-14(8-11)12(17)7-13/h9,11H,4-8,13H2,1-3H3/t11-/m0/s1
InChI key:InChIKey=YYQZPUKTLIRTNY-NSHDSACASA-N
SMILES:N(C(C)C)(C(C)=O)[C@@H]1CN(C(CN)=O)CCC1
Synonyms:
  • Acetamide, N-[(3S)-1-(2-aminoacetyl)-3-piperidinyl]-N-(1-methylethyl)-
  • N-[(3S)-1-(2-Aminoacetyl)-3-piperidinyl]-N-(1-methylethyl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.