CymitQuimica logo

CAS 1354018-68-0

:

N-[(3S)-1-Acetyl-3-piperidinyl]-N-(1-methylethyl)glycine

Description:
N-[(3S)-1-Acetyl-3-piperidinyl]-N-(1-methylethyl)glycine, identified by its CAS number 1354018-68-0, is a chemical compound characterized by its specific structural features, including a piperidine ring and an acetyl group. This compound is classified as an amino acid derivative, which suggests it may exhibit properties typical of both amino acids and piperidine-based compounds. Its molecular structure indicates potential for interactions with biological systems, possibly influencing neurotransmitter pathways or exhibiting pharmacological activity. The presence of the acetyl group may enhance lipophilicity, potentially affecting its bioavailability and permeability across biological membranes. Additionally, the compound's stereochemistry, particularly the (3S) configuration, is crucial for its biological activity, as stereoisomers can exhibit significantly different effects in biological systems. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutics targeting specific receptors or pathways. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C12H22N2O3
InChI:InChI=1S/C12H22N2O3/c1-9(2)14(8-12(16)17)11-5-4-6-13(7-11)10(3)15/h9,11H,4-8H2,1-3H3,(H,16,17)/t11-/m0/s1
InChI key:InChIKey=PHQWAHQGJISWNT-NSHDSACASA-N
SMILES:N(CC(O)=O)(C(C)C)[C@@H]1CN(C(C)=O)CCC1
Synonyms:
  • Glycine, N-[(3S)-1-acetyl-3-piperidinyl]-N-(1-methylethyl)-
  • N-[(3S)-1-Acetyl-3-piperidinyl]-N-(1-methylethyl)glycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.