CAS 1354018-97-5

1,1-Dimethylethyl N-[[(2S)-1-(2-aminoethyl)-2-pyrrolidinyl]methyl]-N-ethylcarbamate

Description:

1,1-Dimethylethyl N-[[(2S)-1-(2-aminoethyl)-2-pyrrolidinyl]methyl]-N-ethylcarbamate, identified by its CAS number 1354018-97-5, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a dimethyl group attached to a tert-butyl moiety, alongside a pyrrolidine ring that incorporates an aminoethyl side chain. The presence of the carbamate functional group indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's stereochemistry, particularly the (2S) configuration, suggests specific spatial arrangements that may influence its biological activity and interactions with biological targets. Additionally, the presence of both ethyl and pyrrolidinyl groups may enhance its solubility and bioavailability. As with many carbamates, it may exhibit properties such as moderate stability under standard conditions, but its reactivity can vary based on environmental factors. Overall, this compound's unique structural features position it as a candidate for further research in various chemical and biological applications.

Formula: C₁₄H₂₉N₃O₂

InChI: InChI=1S/C14H29N3O2/c1-5-16(13(18)19-14(2,3)4)11-12-7-6-9-17(12)10-8-15/h12H,5-11,15H2,1-4H3/t12-/m0/s1

InChI key: InChIKey=HROXEUBMOMASTI-LBPRGKRZSA-N

SMILES: C(N(C(OC(C)(C)C)=O)CC)[C@H]1N(CCN)CCC1

Synonyms:

• 1,1-Dimethylethyl N-[[(2S)-1-(2-aminoethyl)-2-pyrrolidinyl]methyl]-N-ethylcarbamate
• Carbamic acid, N-[[(2S)-1-(2-aminoethyl)-2-pyrrolidinyl]methyl]-N-ethyl-, 1,1-dimethylethyl ester