CymitQuimica logo

CAS 1354020-93-1

:

4-Pyrimidinamine, 6-[(3R)-3-pyrrolidinyloxy]-, hydrochloride (1:1)

Description:
4-Pyrimidinamine, 6-[(3R)-3-pyrrolidinyloxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine and pyrrolidine moieties, which contribute to its biological activity. The presence of the pyrimidinamine structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The hydrochloride salt form indicates enhanced solubility in aqueous environments, making it suitable for formulation in drug development. This compound may exhibit properties such as being a potential inhibitor or modulator of specific enzymes or receptors, which is common among compounds with similar structural features. Its stereochemistry, indicated by the (3R) configuration, may influence its pharmacokinetic and pharmacodynamic profiles, affecting how it interacts with biological systems. As with many compounds in this class, safety and efficacy assessments are crucial for its potential therapeutic applications. Further studies would be necessary to elucidate its specific mechanisms of action and potential therapeutic uses.
Formula:C8H12N4O·ClH
InChI:InChI=1S/C8H12N4O.ClH/c9-7-3-8(12-5-11-7)13-6-1-2-10-4-6;/h3,5-6,10H,1-2,4H2,(H2,9,11,12);1H/t6-;/m1./s1
InChI key:InChIKey=QKTXNEVBNRLJCH-FYZOBXCZSA-N
SMILES:O(C=1C=C(N)N=CN1)[C@@H]2CCNC2.Cl
Synonyms:
  • 4-Pyrimidinamine, 6-[(3R)-3-pyrrolidinyloxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.