CAS 1354025-23-2

(2S)-2-Amino-N-methyl-N-[(1-methyl-2-pyrrolidinyl)methyl]propanamide

Description:

(2S)-2-Amino-N-methyl-N-[(1-methyl-2-pyrrolidinyl)methyl]propanamide, with the CAS number 1354025-23-2, is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group, a methyl group, and a propanamide backbone, which contribute to its potential biological activity. The presence of the pyrrolidine ring indicates that it may interact with biological systems, possibly serving as a ligand for receptors or enzymes. This compound is likely to exhibit solubility in polar solvents due to its amine and amide functionalities, which can engage in hydrogen bonding. Its structural complexity suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Additionally, the stereochemistry (2S) is crucial for its biological activity, as the spatial arrangement of atoms can significantly influence how the molecule interacts with biological targets. Overall, this compound represents a class of molecules that may have significant implications in drug design and development.

Formula: C₁₀H₂₁N₃O

InChI: InChI=1S/C10H21N3O/c1-8(11)10(14)13(3)7-9-5-4-6-12(9)2/h8-9H,4-7,11H2,1-3H3/t8-,9?/m0/s1

InChI key: InChIKey=VGXXHJUNNFSUOF-IENPIDJESA-N

SMILES: C(N(C([C@H](C)N)=O)C)C1N(C)CCC1

Synonyms:

• Propanamide, 2-amino-N-methyl-N-[(1-methyl-2-pyrrolidinyl)methyl]-, (2S)-
• (2S)-2-Amino-N-methyl-N-[(1-methyl-2-pyrrolidinyl)methyl]propanamide