CAS 1354025-29-8

(2S)-2-Amino-1-[3-[[cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidinyl]-3-methyl-1-butanone

Description:

(2S)-2-Amino-1-[3-[[cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidinyl]-3-methyl-1-butanone, with CAS number 1354025-29-8, is a chemical compound characterized by its complex structure, which includes an amino group, a ketone functional group, and a pyrrolidine ring. This compound features a cyclopropyl group attached to a phenylmethyl moiety, contributing to its unique steric and electronic properties. The presence of the chiral center at the second carbon atom indicates that it exists in a specific stereoisomeric form, which can significantly influence its biological activity and interactions. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychological conditions. Its solubility, stability, and reactivity would depend on the specific functional groups and their arrangement, making it essential to consider these factors in practical applications. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various scientific fields.

Formula: C₂₀H₃₁N₃O

InChI: InChI=1S/C20H31N3O/c1-15(2)19(21)20(24)22-11-10-17(13-22)14-23(18-8-9-18)12-16-6-4-3-5-7-16/h3-7,15,17-19H,8-14,21H2,1-2H3/t17?,19-/m0/s1

InChI key: InChIKey=CUMCIWAJMLVAPO-NNBQYGFHSA-N

SMILES: N(CC1CN(C([C@H](C(C)C)N)=O)CC1)(CC2=CC=CC=C2)C3CC3

Synonyms:

• (2S)-2-Amino-1-[3-[[cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidinyl]-3-methyl-1-butanone
• 1-Butanone, 2-amino-1-[3-[[cyclopropyl(phenylmethyl)amino]methyl]-1-pyrrolidinyl]-3-methyl-, (2S)-