CAS 1354028-35-5
:(2S)-2-Amino-3-methyl-N-(1-methylethyl)-N-[(1-methyl-2-pyrrolidinyl)methyl]butanamide
Description:
(2S)-2-Amino-3-methyl-N-(1-methylethyl)-N-[(1-methyl-2-pyrrolidinyl)methyl]butanamide is a synthetic compound characterized by its complex structure, which includes an amino group, a butanamide backbone, and various alkyl and pyrrolidine substituents. This compound is classified as an amide and features chirality at the second carbon, indicating that it exists in a specific stereoisomeric form. Its molecular structure suggests potential interactions with biological systems, particularly in the context of pharmacology, where such compounds may exhibit activity as receptor modulators or inhibitors. The presence of the pyrrolidine ring may contribute to its lipophilicity, influencing its solubility and permeability across biological membranes. Additionally, the compound's unique functional groups may allow for specific binding interactions with target proteins or enzymes. Overall, the characteristics of this compound suggest it may have applications in medicinal chemistry, although detailed studies would be necessary to elucidate its biological activity and therapeutic potential.
Formula:C14H29N3O
InChI:InChI=1S/C14H29N3O/c1-10(2)13(15)14(18)17(11(3)4)9-12-7-6-8-16(12)5/h10-13H,6-9,15H2,1-5H3/t12?,13-/m0/s1
InChI key:InChIKey=QZAGKHDAUDASEO-ABLWVSNPSA-N
SMILES:N(CC1N(C)CCC1)(C([C@H](C(C)C)N)=O)C(C)C
Synonyms:- Butanamide, 2-amino-3-methyl-N-(1-methylethyl)-N-[(1-methyl-2-pyrrolidinyl)methyl]-, (2S)-
- (2S)-2-Amino-3-methyl-N-(1-methylethyl)-N-[(1-methyl-2-pyrrolidinyl)methyl]butanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.