CymitQuimica logo

CAS 13541-00-9

:

BENZYL-(4-CHLORO-BENZYL)-AMINE

Description:
Benzyl-(4-chloro-benzyl)-amine, with the CAS number 13541-00-9, is an organic compound characterized by the presence of both benzyl and 4-chlorobenzyl functional groups attached to an amine. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its moderate solubility in organic solvents, such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic rings. The presence of the chlorine atom on the benzyl group can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Benzyl-(4-chloro-benzyl)-amine may also exhibit biological activity, which could be of interest in medicinal chemistry and drug development. As with many amines, it may have basic properties, allowing it to form salts with acids. Proper handling and safety measures should be observed, as amines can be irritants and may pose health risks upon exposure.
Formula:C14H15ClN
InChI:InChI=1/C14H14ClN/c15-14-8-6-13(7-9-14)11-16-10-12-4-2-1-3-5-12/h1-9,16H,10-11H2/p+1
Synonyms:
  • Benzenemethanamine, 4-chloro-N-(phenylmethyl)-
  • N-Benzyl-1-(4-chlorophenyl)methanamine
  • N-benzyl(4-chlorophenyl)methanaminium
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.