CAS 135410-71-8
:N′-Cyano-N-[(6-methoxy-3-pyridinyl)methyl]-N-methylethanimidamide
Description:
N′-Cyano-N-[(6-methoxy-3-pyridinyl)methyl]-N-methylethanimidamide, with the CAS number 135410-71-8, is a chemical compound characterized by its unique structural features, including a cyano group and a pyridine moiety. This compound typically exhibits properties associated with both its functional groups, such as potential solubility in polar solvents due to the presence of the cyano and methoxy groups. The pyridine ring contributes to its aromatic character, which may influence its reactivity and interaction with biological systems. The imidamide functional group suggests potential for hydrogen bonding, which can affect its stability and interactions in various environments. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural attributes that could facilitate specific biological activities. As with many organic compounds, its behavior in reactions, stability, and potential applications would depend on the specific conditions and environments in which it is utilized.
Formula:C11H14N4O
InChI:InChI=1S/C11H14N4O/c1-9(14-8-12)15(2)7-10-4-5-11(16-3)13-6-10/h4-6H,7H2,1-3H3
InChI key:InChIKey=YUBGMVPGLJDUSZ-UHFFFAOYSA-N
SMILES:C(N(C(=NC#N)C)C)C=1C=CC(OC)=NC1
Synonyms:- Ethanimidamide, N′-cyano-N-[(6-methoxy-3-pyridinyl)methyl]-N-methyl-
- N′-Cyano-N-[(6-methoxy-3-pyridinyl)methyl]-N-methylethanimidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N'-Cyano-N-[(6-methoxy-3-pyridinyl)methyl]-N-methylethanimidamide
CAS:Controlled ProductFormula:C11H14N4OColor and Shape:NeatMolecular weight:218.255
