
CAS 1354223-48-5
:1-Ethyl-1H-indazol-4-amine
Description:
1-Ethyl-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethyl group attached to the nitrogen at the 1-position and an amino group at the 4-position of the indazole ring. It is typically a solid at room temperature and may exhibit properties such as solubility in organic solvents, depending on its specific structure and substituents. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. 1-Ethyl-1H-indazol-4-amine may be of interest in medicinal chemistry and drug development due to its potential biological activity, particularly in relation to its structural similarity to other pharmacologically active compounds. As with many organic compounds, its stability, reactivity, and biological properties would be influenced by factors such as pH, temperature, and the presence of other chemical species.
Formula:C9H11N3
InChI:InChI=1S/C9H11N3/c1-2-12-9-5-3-4-8(10)7(9)6-11-12/h3-6H,2,10H2,1H3
InChI key:InChIKey=LTMWETWKJHMVKS-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(=C(N)C=CC2)C=N1
Synonyms:- (1-Ethyl-1H-indazol-4-yl)amine
- 1-Ethyl-1H-indazol-4-amine
- 1H-Indazol-4-amine, 1-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.