CymitQuimica logo

CAS 13544-10-0

:

6-(Trifluoromethyl)-1H-indole-3-carboxylic acid

Description:
6-(Trifluoromethyl)-1H-indole-3-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The carboxylic acid functional group at the 3-position contributes to its acidity and reactivity, allowing for various chemical transformations. This compound is often utilized in medicinal chemistry and research due to its potential applications in drug development, particularly in the synthesis of biologically active molecules. Its unique electronic properties, imparted by the trifluoromethyl group, can modulate interactions with biological targets, making it a subject of interest in studies related to pharmacology and biochemistry. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.
Formula:C10H6F3NO2
InChI:InChI=1S/C10H6F3NO2/c11-10(12,13)5-1-2-6-7(9(15)16)4-14-8(6)3-5/h1-4,14H,(H,15,16)
InChI key:InChIKey=MUFSVCLYKZROLW-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=CC(C(F)(F)F)=CC2)NC1
Synonyms:
  • Indole-3-carboxylic acid, 6-(trifluoromethyl)-
  • 6-(Trifluoromethyl)-1H-indole-3-carboxylic acid
  • 1H-Indole-3-carboxylic acid, 6-(trifluoromethyl)-
Found 3 products.