CAS 13544-44-0
:2,4-Dichloro-5-iodopyrimidine
Description:
2,4-Dichloro-5-iodopyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two chlorine atoms and one iodine atom. Its molecular structure features a six-membered aromatic ring containing nitrogen atoms, which contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of halogen substituents, specifically chlorine and iodine, enhances its electrophilic properties, making it useful in nucleophilic substitution reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be attributed to the electron-withdrawing nature of the halogens, which can influence the compound's behavior in chemical reactions. Additionally, 2,4-Dichloro-5-iodopyrimidine may serve as an important intermediate in the synthesis of more complex molecules, particularly in the development of biologically active compounds. Safety precautions should be observed when handling this substance, as halogenated compounds can pose health risks and environmental concerns.
Formula:C4HCl2IN2
InChI:InChI=1S/C4HCl2IN2/c5-3-2(7)1-8-4(6)9-3/h1H
InChI key:InChIKey=RGJNPJRAXMSHKN-UHFFFAOYSA-N
SMILES:ClC=1C(I)=CN=C(Cl)N1
Synonyms:- 2,4-Chloro-5-iodopyrimidine
- 2,4-Dichloro-5-Iodopyrimidine
- NSC 97872
- Pyrimidine, 2,4-dichloro-5-iodo-
- 5-Iodo-2,4-dichloropyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,4-Dichloro-5-iodopyrimidine
CAS:Formula:C4HCl2IN2Purity:>98.0%(GC)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:274.872,4-Dichloro-5-Iodopyrimidine
CAS:Formula:C4HCl2IN2Purity:98%Color and Shape:SolidMolecular weight:274.87462,4-Dichloro-5-iodopyrimidine
CAS:Intermediates and Building Blocks - Nucleoside base, Electrophile; Heterocyclic Compounds - Pyrimidine; Scaffolds and TemplatesFormula:C4HCl2IN2Color and Shape:SolidMolecular weight:274.87Ref: TM-TNU0844
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire2,4-Dichloro-5-iodopyrimidine
CAS:2,4-Dichloro-5-iodopyrimidineFormula:C4HCl2IN2Purity:98%Color and Shape: white solidMolecular weight:274.87g/mol2,4-Dichloro-5-iodopyrimidine
CAS:2,4-Dichloro-5-iodopyrimidine is a nucleophilic chemical reagent that can be used to synthesize uracil. It is made by the hydrolysis of 2,4-dichloro-5-iodopyrimidine with sodium hydroxide in water. The reaction yields two isomers which are separated by chromatography. The chemical is used in the synthesis of alkoxides and pyrroles, as well as the synthesis of furans and benzene derivatives. 2,4-Dichloro-5-iodopyrimidine reacts with phosphorus oxychloride to form acetonitrile and oxychloride.Formula:C4HCl2IN2Color and Shape:PowderMolecular weight:274.87 g/mol2,4-Dichloro-5-iodo-pyrimidine
CAS:Formula:C4HCl2IN2Purity:98%Color and Shape:SolidMolecular weight:274.87







