CAS 1354454-97-9

2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile

Description:

2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its bicyclic structure, which includes a pyrrolidine and a pyridine ring. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the nitrogen atoms in the rings enhances its basicity and can influence its interaction with biological targets. Typically, compounds of this nature exhibit moderate to high polarity due to the electronegative nitrogen and cyano groups, which can affect their solubility in various solvents. Additionally, the bicyclic structure may impart unique pharmacological properties, making it of interest in drug discovery and development. The compound's stability, reactivity, and potential biological activity can be influenced by substituents on the rings, making it a versatile scaffold for further chemical modifications. Overall, 2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile represents a significant class of compounds in the realm of organic and medicinal chemistry.

Formula: C₈H₇N₃

InChI: InChI=1S/C8H7N3/c9-5-6-1-3-10-8-7(6)2-4-11-8/h1,3H,2,4H2,(H,10,11)

InChI key: InChIKey=SGOXSUQAESDGFV-UHFFFAOYSA-N

SMILES: C(#N)C1=C2C(NCC2)=NC=C1

Synonyms:

• 2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile
• 1H-Pyrrolo[2,3-b]pyridine-4-carbonitrile, 2,3-dihydro-