CAS 135447-36-8
:phenylacetyl-O-methyltyrosyl-phenylalanyl-glutaminyl-asparaginyl-prolyl-arginyl-tyrosinamide
Description:
Phenylacetyl-O-methyltyrosyl-phenylalanyl-glutaminyl-asparaginyl-prolyl-arginyl-tyrosinamide, with the CAS number 135447-36-8, is a synthetic peptide that exhibits characteristics typical of peptide compounds. It is composed of a sequence of amino acids, which contributes to its structural complexity and potential biological activity. The presence of aromatic amino acids, such as phenylalanine and tyrosine, suggests that the compound may have hydrophobic properties, influencing its solubility and interaction with biological membranes. Additionally, the inclusion of polar amino acids like glutamine and asparagine may enhance its solubility in aqueous environments. This peptide may be of interest in pharmacological research due to its potential role in modulating biological processes, possibly acting as a signaling molecule or influencing receptor interactions. Its specific applications and mechanisms of action would depend on further empirical studies, including its stability, bioavailability, and interaction with target biomolecules. Overall, this compound represents a complex structure with potential implications in medicinal chemistry and biochemistry.
Formula:C62H83N17O13
InChI:InChI=1/C62H83N17O13/c1-92-41-24-20-39(21-25-41)31-45(53(65)84)76-54(85)42(15-8-28-70-61(66)67)74-59(90)49-17-10-30-79(49)60(91)44(16-9-29-71-62(68)69)75-58(89)48(35-51(64)82)78-55(86)43(26-27-50(63)81)73-57(88)47(32-36-11-4-2-5-12-36)77-56(87)46(33-38-18-22-40(80)23-19-38)72-52(83)34-37-13-6-3-7-14-37/h2-7,11-14,18-25,42-49,80H,8-10,15-17,26-35H2,1H3,(H2,63,81)(H2,64,82)(H2,65,84)(H,72,83)(H,73,88)(H,74,90)(H,75,89)(H,76,85)(H,77,87)(H,78,86)(H4,66,67,70)(H4,68,69,71)/t42-,43-,44-,45-,46+,47-,48-,49-/m0/s1
Synonyms:- Phaa-tyr(Me)-phe-gln-asn-arg-pro-arg-tyr-NH2
- Ptmp linear avp antag
- L-Tyrosinamide, O-methyl-N-(phenylacetyl)-D-tyrosyl-L-phenylalanyl-L-glutaminyl-L-asparaginyl-L-arginyl-L-proplyl-L-arginyl-
- Phenylacetyl-O-methyltyrosyl-phenylalanyl-glutaminyl-asparaginyl-prolyl-arginyl-tyrosinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(Phenylac 1,D-Tyr(Me)2,Arg6·8,Tyr-NH29)-Vasopressin trifluoroacetate salt Phenylac-D-Tyr(Me)-Phe-Gln-Asn-Arg-Pro-Arg-Tyr-NH2 tri
CAS:Please enquire for more information about (Phenylac 1,D-Tyr(Me)2,Arg6·8,Tyr-NH29)-Vasopressin trifluoroacetate salt Phenylac-D-Tyr(Me)-Phe-Gln-Asn-Arg-Pro-Arg-Tyr-NH2 tri including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C62H83N17O13Purity:Min. 95%Color and Shape:PowderMolecular weight:1,274.43 g/mol
