CAS 1354484-57-3

L-Proline, 4-[4-(1,1-dimethylpropyl)phenoxy]-, methyl ester, hydrochloride (1:1), (4S)-

Description:

L-Proline, 4-[4-(1,1-dimethylpropyl)phenoxy]-, methyl ester, hydrochloride (1:1), (4S)- is a synthetic compound characterized by its proline backbone, which is an amino acid known for its role in protein synthesis and structural stability. The presence of a 4-(1,1-dimethylpropyl)phenoxy group indicates a significant hydrophobic character, which may influence its solubility and interaction with biological membranes. As a methyl ester, it features an ester functional group that can affect its reactivity and bioavailability. The hydrochloride form suggests that it is a salt, enhancing its stability and solubility in aqueous solutions, which is beneficial for pharmaceutical applications. The (4S) designation indicates the specific stereochemistry at the proline's chiral center, which is crucial for its biological activity. Overall, this compound may exhibit unique pharmacological properties, making it of interest in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways or receptors.

Formula: C₁₇H₂₅NO₃·ClH

InChI: InChI=1S/C17H25NO3.ClH/c1-5-17(2,3)12-6-8-13(9-7-12)21-14-10-15(18-11-14)16(19)20-4;/h6-9,14-15,18H,5,10-11H2,1-4H3;1H/t14-,15-;/m0./s1

InChI key: InChIKey=LDWAZKMUDIGOGN-YYLIZZNMSA-N

SMILES: O([C@H]1C[C@@H](C(OC)=O)NC1)C2=CC=C(C(CC)(C)C)C=C2.Cl

Synonyms:

• L-Proline, 4-[4-(1,1-dimethylpropyl)phenoxy]-, methyl ester, hydrochloride (1:1), (4S)-