CAS 1354484-79-9

L-Proline, 4-[2-(ethoxycarbonyl)phenoxy]-, methyl ester, hydrochloride (1:1), (4S)-

Description:

L-Proline, 4-[2-(ethoxycarbonyl)phenoxy]-, methyl ester, hydrochloride (1:1), (4S)- is a synthetic compound characterized by its unique structure, which includes a proline backbone modified with an ethoxycarbonyl group and a phenoxy moiety. This compound is typically a white to off-white crystalline solid, soluble in water and organic solvents, reflecting its polar nature due to the presence of both hydrophilic and hydrophobic groups. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility. The (4S) designation refers to the specific stereochemistry of the proline residue, which is crucial for its biological activity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its CAS number, 1354484-79-9, allows for precise identification in chemical databases, facilitating research and application in various fields, including drug design and synthesis.

Formula: C₁₅H₁₉NO₅·ClH

InChI: InChI=1S/C15H19NO5.ClH/c1-3-20-14(17)11-6-4-5-7-13(11)21-10-8-12(16-9-10)15(18)19-2;/h4-7,10,12,16H,3,8-9H2,1-2H3;1H/t10-,12-;/m0./s1

InChI key: InChIKey=AQRHVDPWQRTIKO-JGAZGGJJSA-N

SMILES: C(OCC)(=O)C1=C(O[C@H]2C[C@@H](C(OC)=O)NC2)C=CC=C1.Cl

Synonyms:

• L-Proline, 4-[2-(ethoxycarbonyl)phenoxy]-, methyl ester, hydrochloride (1:1), (4S)-