CAS 1354486-82-0

L-Proline, 4-[[(tetrahydro-2H-pyran-4-yl)carbonyl]oxy]-, methyl ester, hydrochloride (1:1), (4S)-

Description:

L-Proline, 4-[[(tetrahydro-2H-pyran-4-yl)carbonyl]oxy]-, methyl ester, hydrochloride (1:1), (4S)- is a chemical compound characterized by its structural complexity, featuring a proline backbone modified with a tetrahydro-2H-pyran moiety. This compound is a derivative of proline, an amino acid known for its role in protein synthesis and its unique cyclic structure, which contributes to the stability of protein conformations. The presence of the methyl ester group indicates that it has been esterified, which can influence its solubility and reactivity. The hydrochloride form suggests that it is a salt, enhancing its stability and solubility in aqueous solutions. The (4S) designation indicates the specific stereochemistry at the proline's chiral center, which is crucial for its biological activity. This compound may have applications in pharmaceuticals or biochemistry, particularly in the synthesis of peptides or as a building block in drug development. Its unique structural features and stereochemistry make it an interesting subject for further research in medicinal chemistry and related fields.

Formula: C₁₂H₁₉NO₅·ClH

InChI: InChI=1S/C12H19NO5.ClH/c1-16-12(15)10-6-9(7-13-10)18-11(14)8-2-4-17-5-3-8;/h8-10,13H,2-7H2,1H3;1H/t9-,10-;/m0./s1

InChI key: InChIKey=XTONLIBWHLBVMB-IYPAPVHQSA-N

SMILES: O(C(=O)C1CCOCC1)[C@H]2C[C@@H](C(OC)=O)NC2.Cl

Synonyms:

• L-Proline, 4-[[(tetrahydro-2H-pyran-4-yl)carbonyl]oxy]-, methyl ester, hydrochloride (1:1), (4S)-