CAS 135459-90-4: Ranelic acid
Description:Ranelic acid, with the CAS number 135459-90-4, is a chemical compound that serves as a novel therapeutic agent, primarily in the context of treating conditions related to the regulation of nitric oxide in the body. It is characterized by its unique structure, which includes a sulfonic acid group and a carboxylic acid group, contributing to its solubility in water and potential for biological activity. Ranelic acid is known for its role as a nitric oxide donor, which can influence various physiological processes, including vasodilation and neurotransmission. The compound has been investigated for its potential applications in cardiovascular health and neuroprotection. Additionally, its pharmacological profile suggests that it may have antioxidant properties, which could be beneficial in mitigating oxidative stress-related conditions. As with many chemical substances, the safety and efficacy of ranelic acid in clinical settings are subjects of ongoing research, and its use is guided by regulatory standards to ensure patient safety.
Formula:C12H10N2O8S
InChI:InChI=1S/C12H10N2O8S/c13-2-6-5(1-7(15)16)10(12(21)22)23-11(6)14(3-8(17)18)4-9(19)20/h1,3-4H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22)
InChI key:InChIKey=DJSXNILVACEBLP-UHFFFAOYSA-N
SMILES:N#CC1=C(SC(C(=O)O)=C1CC(=O)O)N(CC(=O)O)CC(=O)O
- Synonyms:
- 3-Thiopheneacetic acid, 5-[bis(carboxymethyl)amino]-2-carboxy-4-cyano-
- 5-[Bis(carboxymethyl)amino]-2-carboxy-4-cyano-3-thiopheneacetic acid
- Ranelic
- Ranelic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ranelic acid REF: TM-T26041CAS: 135459-90-4 | 98% | 1,444.00 € | Mon 10 Mar 25 |
![]() | Ranelic acid REF: 3D-KFA45990CAS: 135459-90-4 | Min. 95% | - - - | Discontinued product |

Ranelic acid
Ref: TM-T26041
25mg | 1,444.00 € |

Ranelic acid
Ref: 3D-KFA45990
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |