CAS 1354703-44-8

4-Iodo-3-nitro-5-(trifluoromethyl)-1H-pyrazole

Description:

4-Iodo-3-nitro-5-(trifluoromethyl)-1H-pyrazole is a heterocyclic organic compound characterized by its pyrazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of an iodine atom at the 4-position and a nitro group at the 3-position contributes to its reactivity and potential applications in various chemical reactions. The trifluoromethyl group at the 5-position enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound is typically synthesized through multi-step reactions involving halogenation and nitration processes. Its unique structure allows for potential applications in agrochemicals, pharmaceuticals, and materials science. The compound's physical properties, such as solubility and melting point, can vary based on the specific conditions and purity. As with many halogenated compounds, it is important to handle it with care due to potential toxicity and environmental impact. Overall, 4-Iodo-3-nitro-5-(trifluoromethyl)-1H-pyrazole represents a valuable compound for research and development in various chemical fields.

Formula: C₄HF₃IN₃O₂

InChI: InChI=1S/C4HF3IN3O2/c5-4(6,7)2-1(8)3(10-9-2)11(12)13/h(H,9,10)

InChI key: InChIKey=VWMNGTOHCFWJJB-UHFFFAOYSA-N

SMILES: IC1=C(C(F)(F)F)NN=C1N(=O)=O

Synonyms:

• 1H-Pyrazole, 4-iodo-3-nitro-5-(trifluoromethyl)-
• 4-Iodo-3-nitro-5-(trifluoromethyl)-1H-pyrazole