CymitQuimica logo

CAS 1354703-49-3

:

4-Iodo-1-methyl-3-nitro-1H-pyrazole-5-carbonitrile

Description:
4-Iodo-1-methyl-3-nitro-1H-pyrazole-5-carbonitrile is a heterocyclic organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of the iodo group introduces significant electronegativity, influencing the compound's reactivity and potential applications in medicinal chemistry. The nitro group contributes to the compound's polarity and can enhance its biological activity, making it a candidate for various pharmaceutical applications. The carbonitrile functional group adds to the compound's versatility, allowing for potential interactions in chemical synthesis and biological systems. This compound is typically synthesized through multi-step reactions involving specific reagents and conditions to ensure the correct substitution patterns. Its unique combination of functional groups may impart interesting properties, such as increased solubility in polar solvents and potential for forming hydrogen bonds, which can be critical in drug design and development. Overall, 4-Iodo-1-methyl-3-nitro-1H-pyrazole-5-carbonitrile represents a valuable structure in the field of organic chemistry and pharmacology.
Formula:C5H3IN4O2
InChI:InChI=1S/C5H3IN4O2/c1-9-3(2-7)4(6)5(8-9)10(11)12/h1H3
InChI key:InChIKey=GLTSCIPAEIARTF-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(I)=C(C#N)N(C)N1
Synonyms:
  • 4-Iodo-1-methyl-3-nitro-1H-pyrazole-5-carbonitrile
  • 1H-Pyrazole-5-carbonitrile, 4-iodo-1-methyl-3-nitro-
Found 1 products.