CAS 1354703-80-2

Methyl 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2-propynoate

Description:

Methyl 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2-propynoate is a chemical compound characterized by its unique structure, which includes a methyl ester functional group and a pyrazole ring. This compound features a propynoate moiety, indicating the presence of a triple bond between carbon atoms, which contributes to its reactivity and potential applications in organic synthesis. The pyrazole ring, substituted with ethyl and methyl groups, enhances its biological activity and may influence its solubility and stability. Typically, compounds of this nature are investigated for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic reactions. The presence of multiple functional groups suggests that it may exhibit diverse chemical behavior, including nucleophilic and electrophilic reactivity. Additionally, the molecular structure may impart specific physical properties such as boiling point, melting point, and solubility, which are crucial for its practical applications. Overall, Methyl 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2-propynoate represents a complex organic molecule with potential significance in various chemical fields.

Formula: C₁₁H₁₄N₂O₂

InChI: InChI=1S/C11H14N2O2/c1-5-13-9(3)10(8(2)12-13)6-7-11(14)15-4/h5H2,1-4H3

InChI key: InChIKey=JTSRXPUKDCPFPK-UHFFFAOYSA-N

SMILES: C(#CC(OC)=O)C1=C(C)N(CC)N=C1C

Synonyms:

• Methyl 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2-propynoate
• 2-Propynoic acid, 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-, methyl ester