CymitQuimica logo

CAS 1354704-07-6

:

3-(Difluoromethyl)-4-iodo-1H-pyrazole

Description:
3-(Difluoromethyl)-4-iodo-1H-pyrazole is a heterocyclic organic compound characterized by the presence of a pyrazole ring, which consists of two adjacent nitrogen atoms within a five-membered ring. The compound features a difluoromethyl group (-CF2H) and an iodine atom attached to the pyrazole structure, contributing to its unique chemical properties. The difluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. The iodine substituent can also affect the compound's electronic properties and stability. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its synthesis typically involves multi-step reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography. Overall, 3-(Difluoromethyl)-4-iodo-1H-pyrazole represents a versatile structure with significant implications in various chemical research fields.
Formula:C4H3F2IN2
InChI:InChI=1S/C4H3F2IN2/c5-4(6)3-2(7)1-8-9-3/h1,4H,(H,8,9)
InChI key:InChIKey=WQDDVJJKEMZJCQ-UHFFFAOYSA-N
SMILES:C(F)(F)C=1C(I)=CNN1
Synonyms:
  • 1H-Pyrazole, 3-(difluoromethyl)-4-iodo-
  • 3-(Difluoromethyl)-4-iodo-1H-pyrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.