CAS 1354704-30-5

4-Iodo-5-methyl-1-(1-methylethyl)-3-nitro-1H-pyrazole

Description:

4-Iodo-5-methyl-1-(1-methylethyl)-3-nitro-1H-pyrazole is a chemical compound characterized by its unique structural features, including a pyrazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of an iodine atom at the 4-position and a nitro group at the 3-position contributes to its reactivity and potential applications in various chemical reactions. The methyl and isopropyl substituents enhance its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural motifs, making it a candidate for research in medicinal chemistry. Additionally, the presence of the nitro group can impart specific electronic properties, affecting its reactivity and stability. Overall, 4-Iodo-5-methyl-1-(1-methylethyl)-3-nitro-1H-pyrazole is a complex molecule with potential utility in synthetic chemistry and drug development, warranting further investigation into its properties and applications.

Formula: C₇H₁₀IN₃O₂

InChI: InChI=1S/C7H10IN3O2/c1-4(2)10-5(3)6(8)7(9-10)11(12)13/h4H,1-3H3

InChI key: InChIKey=UJKNRROSHSYKIV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(I)=C(C)N(C(C)C)N1

Synonyms:

• 1H-Pyrazole, 4-iodo-5-methyl-1-(1-methylethyl)-3-nitro-
• 4-Iodo-5-methyl-1-(1-methylethyl)-3-nitro-1H-pyrazole