CAS 1354704-32-7

4,6-Bis(difluoromethyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

Description:

4,6-Bis(difluoromethyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features two difluoromethyl groups at the 4 and 6 positions, contributing to its unique electronic properties and potential reactivity. The presence of a carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents, making it suitable for various chemical reactions and applications. The methyl group at the 1-position adds to the steric and electronic characteristics of the molecule. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its fluorinated groups can influence lipophilicity and metabolic stability, which are critical factors in pharmacokinetics. Overall, 4,6-Bis(difluoromethyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a complex molecule with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₇F₄N₃O₂

InChI: InChI=1S/C10H7F4N3O2/c1-17-9-5(6(16-17)10(18)19)3(7(11)12)2-4(15-9)8(13)14/h2,7-8H,1H3,(H,18,19)

InChI key: InChIKey=ZWBFGFDBSAHCPF-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C2C(=NC(C(F)F)=C1)N(C)N=C2C(O)=O

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4,6-bis(difluoromethyl)-1-methyl-
• 4,6-Bis(difluoromethyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

4,6-Bis(difluoromethyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

CAS: 1354704-32-7

Versatile small molecule scaffold

Formula: C₁₀H₇F₄N₃O₂

Purity: Min. 95%

Molecular weight: 277.17 g/mol

Ref: 3D-EEC70432