CymitQuimica logo

CAS 1354704-36-1

:

1-(Difluoromethyl)-4-iodo-5-methyl-1H-pyrazole-3-carboxylic acid

Description:
1-(Difluoromethyl)-4-iodo-5-methyl-1H-pyrazole-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a difluoromethyl group and an iodine atom introduces significant electronegative elements, influencing the compound's reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, making it suitable for various chemical reactions, including esterification and amidation. The methyl group at the 5-position of the pyrazole ring can affect the compound's steric and electronic properties, potentially enhancing its biological activity. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development and agrochemical applications. Its unique combination of functional groups and structural features allows for diverse interactions in biological systems, warranting investigation into its potential therapeutic uses.
Formula:C6H5F2IN2O2
InChI:InChI=1S/C6H5F2IN2O2/c1-2-3(9)4(5(12)13)10-11(2)6(7)8/h6H,1H3,(H,12,13)
InChI key:InChIKey=KIVNZLQJJVOXQU-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(I)=C(C)N(C(F)F)N1
Synonyms:
  • 1-(Difluoromethyl)-4-iodo-5-methyl-1H-pyrazole-3-carboxylic acid
  • 1H-Pyrazole-3-carboxylic acid, 1-(difluoromethyl)-4-iodo-5-methyl-
Found 1 products.