CymitQuimica logo

CAS 1354704-45-2

:

1-Cyclopentyl-3-ethynyl-1H-pyrazole

Description:
1-Cyclopentyl-3-ethynyl-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a cyclopentyl group and an ethynyl group. The presence of the pyrazole moiety suggests potential biological activity, as pyrazoles are often found in pharmaceuticals and agrochemicals. The cyclopentyl group contributes to the compound's hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The ethynyl group introduces a triple bond, which can enhance reactivity and may allow for further chemical modifications. This compound may exhibit interesting properties such as stability under certain conditions, and its synthesis typically involves multi-step organic reactions. Its applications could range from medicinal chemistry to materials science, depending on its specific interactions and reactivity. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C10H12N2
InChI:InChI=1S/C10H12N2/c1-2-9-7-8-12(11-9)10-5-3-4-6-10/h1,7-8,10H,3-6H2
InChI key:InChIKey=WDVCCLUDDUVPGF-UHFFFAOYSA-N
SMILES:C(#C)C1=NN(C=C1)C2CCCC2
Synonyms:
  • 1-Cyclopentyl-3-ethynyl-1H-pyrazole
  • 1H-Pyrazole, 1-cyclopentyl-3-ethynyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.