CAS 1354704-49-6

3-Bromo-1H-pyrazole-1-acetic acid

Description:

3-Bromo-1H-pyrazole-1-acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 3-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The acetic acid functional group at the 1-position enhances its solubility in polar solvents and may influence its biological activity. This compound is typically used in medicinal chemistry and research due to its potential as a building block for more complex molecules. It may exhibit various biological activities, making it of interest in pharmaceutical development. The compound's properties, such as melting point, boiling point, and solubility, can vary based on its purity and the conditions under which it is handled. As with many brominated compounds, it is essential to consider safety and environmental regulations when working with 3-Bromo-1H-pyrazole-1-acetic acid, as bromine can be hazardous.

Formula: C₅H₅BrN₂O₂

InChI: InChI=1S/C5H5BrN2O2/c6-4-1-2-8(7-4)3-5(9)10/h1-2H,3H2,(H,9,10)

InChI key: InChIKey=GZXQMIQTZFEXFO-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1N=C(Br)C=C1

Synonyms:

• 1H-Pyrazole-1-acetic acid, 3-bromo-
• 3-Bromo-1H-pyrazole-1-acetic acid

2-(3-Bromo-1H-pyrazol-1-yl)acetic acid

CAS: 1354704-49-6

Versatile small molecule scaffold

Formula: C₅H₅BrN₂O₂

Purity: Min. 95%

Molecular weight: 205.01 g/mol

Ref: 3D-EEC70449