CAS 1354704-50-9

3-(1-Cyclopentyl-1H-pyrazol-3-yl)-2-propynoic acid

Description:

3-(1-Cyclopentyl-1H-pyrazol-3-yl)-2-propynoic acid, with the CAS number 1354704-50-9, is a chemical compound characterized by its unique structure that includes a cyclopentyl group and a pyrazole moiety. This compound features a propynoic acid functional group, which contributes to its acidity and potential reactivity. The presence of the pyrazole ring suggests possible biological activity, as pyrazoles are often found in pharmaceuticals and agrochemicals. The cyclopentyl substituent may influence the compound's lipophilicity and steric properties, potentially affecting its interaction with biological targets. In terms of solubility, the presence of both hydrophobic and hydrophilic components in its structure may lead to variable solubility in different solvents. Overall, this compound's unique structural features may confer specific chemical properties and biological activities, making it of interest in medicinal chemistry and related fields. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1S/C11H12N2O2/c14-11(15)6-5-9-7-8-13(12-9)10-3-1-2-4-10/h7-8,10H,1-4H2,(H,14,15)

InChI key: InChIKey=YCLGHYNHIZARJH-UHFFFAOYSA-N

SMILES: C(#CC(O)=O)C1=NN(C=C1)C2CCCC2

Synonyms:

• 3-(1-Cyclopentyl-1H-pyrazol-3-yl)-2-propynoic acid
• 2-Propynoic acid, 3-(1-cyclopentyl-1H-pyrazol-3-yl)-