CAS 1354704-71-4

2-(1-Methyl-1H-pyrazol-3-yl)-4-quinolinemethanol

Description:

2-(1-Methyl-1H-pyrazol-3-yl)-4-quinolinemethanol, identified by its CAS number 1354704-71-4, is a chemical compound that features a unique structure combining a quinoline moiety with a pyrazole group. This compound typically exhibits characteristics such as moderate solubility in organic solvents and potential bioactivity due to the presence of both heterocyclic rings. The pyrazole and quinoline components may contribute to its pharmacological properties, making it of interest in medicinal chemistry. The hydroxymethyl group attached to the quinoline ring can participate in hydrogen bonding, influencing its interactions with biological targets. Additionally, the compound may exhibit various chemical reactivities, including potential for further derivatization, which can be explored for developing new therapeutic agents. Its specific applications and behavior in biological systems would depend on further empirical studies, including its stability, reactivity, and interaction with other molecules. Overall, this compound represents a class of heterocyclic compounds that are often investigated for their potential in drug development and other chemical applications.

Formula: C₁₄H₁₃N₃O

InChI: InChI=1S/C14H13N3O/c1-17-7-6-13(16-17)14-8-10(9-18)11-4-2-3-5-12(11)15-14/h2-8,18H,9H2,1H3

InChI key: InChIKey=UPYWWZNVVXWAKJ-UHFFFAOYSA-N

SMILES: C(O)C1=CC(=NC2=C1C=CC=C2)C=3C=CN(C)N3

Synonyms:

• 4-Quinolinemethanol, 2-(1-methyl-1H-pyrazol-3-yl)-
• 2-(1-Methyl-1H-pyrazol-3-yl)-4-quinolinemethanol