CAS 1354704-75-8

4-Iodo-5-methyl-1-propyl-1H-pyrazol-3-amine

Description:

4-Iodo-5-methyl-1-propyl-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of an iodine atom at the 4-position and a methyl group at the 5-position, along with a propyl group at the 1-position, contributes to its unique properties. This compound is likely to exhibit moderate to high lipophilicity due to the hydrophobic alkyl groups, which can influence its solubility in organic solvents. The amino group at the 3-position can participate in hydrogen bonding, making it potentially reactive in various chemical reactions. Additionally, the presence of iodine may impart specific reactivity, such as in nucleophilic substitution reactions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrazole derivatives. However, specific biological activity and toxicity profiles would require further investigation through experimental studies.

Formula: C₇H₁₂IN₃

InChI: InChI=1S/C7H12IN3/c1-3-4-11-5(2)6(8)7(9)10-11/h3-4H2,1-2H3,(H2,9,10)

InChI key: InChIKey=RVMVZJGIZJADIO-UHFFFAOYSA-N

SMILES: C(CC)N1C(C)=C(I)C(N)=N1

Synonyms:

• 4-Iodo-5-methyl-1-propyl-1H-pyrazol-3-amine
• 1H-Pyrazol-3-amine, 4-iodo-5-methyl-1-propyl-