
CAS 1354704-80-5
:3-Iodo-1-(2-methylpropyl)-1H-pyrazole
Description:
3-Iodo-1-(2-methylpropyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of an iodine atom at the 3-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. The substituent at the 1-position, a 2-methylpropyl group, adds to the compound's hydrophobic character, influencing its solubility and interaction with biological systems. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new drugs or as intermediates in synthetic pathways. Additionally, the presence of halogens like iodine can enhance the compound's properties, such as lipophilicity and metabolic stability. Overall, 3-Iodo-1-(2-methylpropyl)-1H-pyrazole represents a versatile structure with potential utility in various fields of chemistry and pharmacology.
Formula:C7H11IN2
InChI:InChI=1S/C7H11IN2/c1-6(2)5-10-4-3-7(8)9-10/h3-4,6H,5H2,1-2H3
InChI key:InChIKey=IQYHSOPETXHHNA-UHFFFAOYSA-N
SMILES:C(C(C)C)N1N=C(I)C=C1
Synonyms:- 3-Iodo-1-(2-methylpropyl)-1H-pyrazole
- 1H-Pyrazole, 3-iodo-1-(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.