
CAS 1354704-83-8
:1-Propyl-1H-pyrazole-3-sulfonyl chloride
Description:
1-Propyl-1H-pyrazole-3-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a pyrazole ring, a five-membered aromatic heterocycle containing two nitrogen atoms, which contributes to its unique chemical properties. The presence of the propyl group enhances its hydrophobic characteristics, influencing its solubility and reactivity in various organic reactions. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, particularly for the introduction of sulfonyl groups into other molecules. It may also serve as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound is likely to be sensitive to moisture, as sulfonyl chlorides can hydrolyze to form sulfonic acids. Proper handling and storage under anhydrous conditions are essential to maintain its stability and reactivity. Safety precautions should be observed due to its potential irritant properties and reactivity with nucleophiles.
Formula:C6H9ClN2O2S
InChI:InChI=1S/C6H9ClN2O2S/c1-2-4-9-5-3-6(8-9)12(7,10)11/h3,5H,2,4H2,1H3
InChI key:InChIKey=UATWHIVZUZGPAC-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=NN(CCC)C=C1
Synonyms:- 1-Propyl-1H-pyrazole-3-sulfonyl chloride
- 1H-Pyrazole-3-sulfonyl chloride, 1-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.