
CAS 1354704-88-3
:4-Iodo-1-(1-methylethyl)-3-nitro-1H-pyrazole
Description:
4-Iodo-1-(1-methylethyl)-3-nitro-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with an iodine atom, a nitro group, and an isopropyl group. The presence of the iodine atom contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential biological activity. Its molecular structure suggests that it may exhibit interesting pharmacological properties, making it a candidate for further investigation in drug development. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific formulation and purity. Safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C6H8IN3O2
InChI:InChI=1S/C6H8IN3O2/c1-4(2)9-3-5(7)6(8-9)10(11)12/h3-4H,1-2H3
InChI key:InChIKey=VNIRSUXQUBIGBW-UHFFFAOYSA-N
SMILES:C(C)(C)N1N=C(N(=O)=O)C(I)=C1
Synonyms:- 1H-Pyrazole, 4-iodo-1-(1-methylethyl)-3-nitro-
- 4-Iodo-1-(1-methylethyl)-3-nitro-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.