CAS 1354704-92-9

4-(4-Fluorophenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

Description:

4-(4-Fluorophenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a chemical compound characterized by its unique pyrazolo-pyridine structure, which incorporates a fluorophenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. The presence of the fluorine atom can influence the compound's lipophilicity and reactivity, potentially enhancing its pharmacological properties. The carboxylic acid group contributes to its acidity and can participate in hydrogen bonding, which may affect solubility and interaction with biological targets. Additionally, the methyl group on the pyrazole ring can influence steric hindrance and electronic properties. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing molecules with specific biological activities or therapeutic applications. Its precise characteristics, such as melting point, solubility, and spectral data, would require experimental determination or reference to specific literature.

Formula: C₁₄H₁₀FN₃O₂

InChI: InChI=1S/C14H10FN3O2/c1-18-13-11(12(17-18)14(19)20)10(6-7-16-13)8-2-4-9(15)5-3-8/h2-7H,1H3,(H,19,20)

InChI key: InChIKey=MUPHALGJLSBPQA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CN=C2N(C)N1)C3=CC=C(F)C=C3

Synonyms:

• 4-(4-Fluorophenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid
• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4-(4-fluorophenyl)-1-methyl-