CymitQuimica logo

CAS 1354704-97-4

:

1-(Cyclopropylmethyl)-4-iodo-3-nitro-1H-pyrazole

Description:
1-(Cyclopropylmethyl)-4-iodo-3-nitro-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a cyclopropylmethyl group, an iodine atom, and a nitro group. The presence of the iodine atom contributes to its potential reactivity, making it a candidate for various chemical transformations. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This compound may exhibit interesting biological activities due to its structural motifs, making it of interest in medicinal chemistry and drug development. Additionally, the cyclopropylmethyl group can impart unique steric and electronic properties, potentially affecting the compound's interaction with biological targets. Overall, 1-(Cyclopropylmethyl)-4-iodo-3-nitro-1H-pyrazole represents a complex molecule with potential applications in research and industry, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C7H8IN3O2
InChI:InChI=1S/C7H8IN3O2/c8-6-4-10(3-5-1-2-5)9-7(6)11(12)13/h4-5H,1-3H2
InChI key:InChIKey=CWRDXNVYSPTRGL-UHFFFAOYSA-N
SMILES:C(N1N=C(N(=O)=O)C(I)=C1)C2CC2
Synonyms:
  • 1-(Cyclopropylmethyl)-4-iodo-3-nitro-1H-pyrazole
  • 1H-Pyrazole, 1-(cyclopropylmethyl)-4-iodo-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.