CAS 1354705-03-5

4-(3,4-Dimethoxyphenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

Description:

4-(3,4-Dimethoxyphenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core fused with a dimethoxyphenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, including anti-inflammatory or analgesic effects, due to its unique molecular configuration. The presence of the dimethoxyphenyl group may enhance lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the carboxylic acid group can participate in hydrogen bonding and ionic interactions, which may play a role in its reactivity and interaction with biological targets. The compound's specific applications and efficacy would depend on further pharmacological studies, but its structural features suggest potential utility in medicinal chemistry. As with many organic compounds, stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species.

Formula: C₁₆H₁₅N₃O₄

InChI: InChI=1S/C16H15N3O4/c1-19-15-13(14(18-19)16(20)21)10(6-7-17-15)9-4-5-11(22-2)12(8-9)23-3/h4-8H,1-3H3,(H,20,21)

InChI key: InChIKey=JIIKUPLAJWQPJN-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CN=C2N(C)N1)C3=CC(OC)=C(OC)C=C3

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4-(3,4-dimethoxyphenyl)-1-methyl-
• 4-(3,4-Dimethoxyphenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid