CymitQuimica logo

CAS 1354705-04-6

:

3-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-2-propynoic acid

Description:
3-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-2-propynoic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a propynoic acid moiety. The presence of the ethyl and methyl groups on the pyrazole ring contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. This compound may exhibit interesting biological activities due to the pyrazole moiety, which is often associated with various pharmacological properties. The propynoic acid functional group introduces acidity and can participate in various chemical reactions, including esterification and amidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-2-propynoic acid represents a versatile building block in organic synthesis and drug development.
Formula:C9H10N2O2
InChI:InChI=1S/C9H10N2O2/c1-3-11-7(2)8(6-10-11)4-5-9(12)13/h6H,3H2,1-2H3,(H,12,13)
InChI key:InChIKey=TYOFRYVOUGRLST-UHFFFAOYSA-N
SMILES:C(#CC(O)=O)C1=C(C)N(CC)N=C1
Synonyms:
  • 3-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-2-propynoic acid
  • 2-Propynoic acid, 3-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.