CAS 1354705-06-8

4-Iodo-α,3,5-trimethyl-1H-pyrazole-1-acetic acid

Description:

4-Iodo-α,3,5-trimethyl-1H-pyrazole-1-acetic acid is a chemical compound characterized by its unique pyrazole structure, which includes an iodine substituent and multiple methyl groups. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the iodine atom enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The trimethyl groups provide steric hindrance, which can affect the compound's interactions with biological targets. Additionally, the pyrazole ring is known for its diverse pharmacological properties, including anti-inflammatory and analgesic effects. The compound's solubility and stability can vary based on environmental conditions, such as pH and temperature. Overall, 4-Iodo-α,3,5-trimethyl-1H-pyrazole-1-acetic acid represents a complex structure with potential applications in drug development and research, particularly in the fields of organic synthesis and medicinal chemistry.

Formula: C₈H₁₁IN₂O₂

InChI: InChI=1S/C8H11IN2O2/c1-4-7(9)5(2)11(10-4)6(3)8(12)13/h6H,1-3H3,(H,12,13)

InChI key: InChIKey=QYLVULGPWMGYBE-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C)N1C(C)=C(I)C(C)=N1

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-iodo-α,3,5-trimethyl-
• 4-Iodo-α,3,5-trimethyl-1H-pyrazole-1-acetic acid