CAS 1354705-15-9
:5-Ethyl-4-iodo-1-methyl-1H-pyrazole
Description:
5-Ethyl-4-iodo-1-methyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. The presence of an ethyl group at the 5-position and an iodine atom at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. The iodine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the methyl group at the 1-position can affect the compound's steric and electronic properties. 5-Ethyl-4-iodo-1-methyl-1H-pyrazole may find applications in medicinal chemistry, agrochemicals, or as an intermediate in organic synthesis. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental impact.
Formula:C6H9IN2
InChI:InChI=1S/C6H9IN2/c1-3-6-5(7)4-8-9(6)2/h4H,3H2,1-2H3
InChI key:InChIKey=XUJVSPFBCWWSLF-UHFFFAOYSA-N
SMILES:C(C)C1=C(I)C=NN1C
Synonyms:- 5-Ethyl-4-iodo-1-methyl-1H-pyrazole
- 1H-Pyrazole, 5-ethyl-4-iodo-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.