
CAS 1354705-17-1
:1-Cyclopentyl-4-iodo-3-methyl-1H-pyrazole
Description:
1-Cyclopentyl-4-iodo-3-methyl-1H-pyrazole is a chemical compound characterized by its unique pyrazole structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. The presence of a cyclopentyl group and an iodine atom at specific positions on the pyrazole ring contributes to its distinct chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the cyclopentyl moiety, which can influence its solubility in organic solvents. The iodine substituent may impart specific reactivity, making it a potential candidate for further chemical transformations or applications in medicinal chemistry. Additionally, the methyl group at the 3-position can affect the compound's electronic properties and steric hindrance. Overall, 1-Cyclopentyl-4-iodo-3-methyl-1H-pyrazole may have applications in drug development or as an intermediate in organic synthesis, although specific biological activities or uses would require further investigation.
Formula:C9H13IN2
InChI:InChI=1S/C9H13IN2/c1-7-9(10)6-12(11-7)8-4-2-3-5-8/h6,8H,2-5H2,1H3
InChI key:InChIKey=CSBGTFDZFHFOEL-UHFFFAOYSA-N
SMILES:IC1=CN(N=C1C)C2CCCC2
Synonyms:- 1-Cyclopentyl-4-iodo-3-methyl-1H-pyrazole
- 1H-Pyrazole, 1-cyclopentyl-4-iodo-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.