
CAS 1354705-24-0
:4-Iodo-5-methyl-1-(1-methylethyl)-1H-pyrazole
Description:
4-Iodo-5-methyl-1-(1-methylethyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of an iodine atom at the 4-position and a methyl group at the 5-position contributes to its unique reactivity and potential applications in various chemical reactions. The isopropyl group at the 1-position enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential for participation in electrophilic substitution reactions due to the electron-withdrawing nature of the iodine atom. Additionally, the presence of multiple functional groups may allow for further derivatization, expanding its utility in synthetic chemistry. Overall, 4-Iodo-5-methyl-1-(1-methylethyl)-1H-pyrazole represents a versatile scaffold for the development of new chemical entities.
Formula:C7H11IN2
InChI:InChI=1S/C7H11IN2/c1-5(2)10-6(3)7(8)4-9-10/h4-5H,1-3H3
InChI key:InChIKey=UWRMEIAPKOQNFE-UHFFFAOYSA-N
SMILES:C(C)(C)N1C(C)=C(I)C=N1
Synonyms:- 4-Iodo-5-methyl-1-(1-methylethyl)-1H-pyrazole
- 1H-Pyrazole, 4-iodo-5-methyl-1-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.