CAS 1354705-25-1

4-Iodo-3-methyl-1H-pyrazole-1-butanoic acid

Description:

4-Iodo-3-methyl-1H-pyrazole-1-butanoic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with an iodine atom and a methyl group, along with a butanoic acid moiety. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids. The presence of the iodine atom can influence its reactivity and solubility, often enhancing its biological activity. The pyrazole ring contributes to its potential as a pharmacophore in medicinal chemistry, making it of interest in drug development. Additionally, the butanoic acid portion may impart acidic properties, allowing for interactions with various biological targets. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point, boiling point, and solubility in different solvents. Overall, 4-Iodo-3-methyl-1H-pyrazole-1-butanoic acid is a compound of interest in both synthetic and medicinal chemistry due to its diverse functional groups and potential applications.

Formula: C₈H₁₁IN₂O₂

InChI: InChI=1S/C8H11IN2O2/c1-6-7(9)5-11(10-6)4-2-3-8(12)13/h5H,2-4H2,1H3,(H,12,13)

InChI key: InChIKey=LYVDBMZZVKLUIN-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)N1C=C(I)C(C)=N1

Synonyms:

• 4-Iodo-3-methyl-1H-pyrazole-1-butanoic acid
• 1H-Pyrazole-1-butanoic acid, 4-iodo-3-methyl-

4-(4-Iodo-3-methyl-1H-pyrazol-1-yl)butanoic acid

CAS: 1354705-25-1

Versatile small molecule scaffold

Formula: C₈H₁₁IN₂O₂

Purity: Min. 95%

Molecular weight: 294.09 g/mol

Ref: 3D-EEC70525