CymitQuimica logo

CAS 1354705-32-0

:

1-(2,2-Difluoroethyl)-4-iodo-1H-pyrazole-3-carbonitrile

Description:
1-(2,2-Difluoroethyl)-4-iodo-1H-pyrazole-3-carbonitrile is a chemical compound characterized by its unique structural features, which include a pyrazole ring, a carbonitrile group, and both difluoroethyl and iodo substituents. The presence of the difluoroethyl group imparts notable fluorine-related properties, such as increased lipophilicity and potential bioactivity, while the iodo substituent can enhance the compound's reactivity and influence its interaction with biological targets. The carbonitrile functional group contributes to the compound's polarity and can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its stability and solubility would depend on the specific conditions and solvents used. Overall, this compound represents a class of halogenated and fluorinated organic molecules that are of interest in both synthetic and applied chemistry contexts.
Formula:C6H4F2IN3
InChI:InChI=1S/C6H4F2IN3/c7-6(8)3-12-2-4(9)5(1-10)11-12/h2,6H,3H2
InChI key:InChIKey=NOTLBDJJJVZQRP-UHFFFAOYSA-N
SMILES:C(C(F)F)N1N=C(C#N)C(I)=C1
Synonyms:
  • 1H-Pyrazole-3-carbonitrile, 1-(2,2-difluoroethyl)-4-iodo-
  • 1-(2,2-Difluoroethyl)-4-iodo-1H-pyrazole-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.