
CAS 1354705-39-7
:4-Iodo-5-methyl-3-nitro-1-propyl-1H-pyrazole
Description:
4-Iodo-5-methyl-3-nitro-1-propyl-1H-pyrazole is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of an iodine atom at the 4-position and a nitro group at the 3-position contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methyl group at the 5-position and the propyl group at the 1-position provide additional steric and electronic effects that can influence the compound's properties. This compound may exhibit biological activity, making it of interest for research in medicinal chemistry. Its molecular structure suggests potential for interactions with biological targets, and its unique functional groups may impart specific chemical reactivity. As with many halogenated compounds, it is essential to consider its environmental impact and stability under various conditions. Proper handling and safety measures should be observed due to the presence of iodine and nitro groups, which can pose health and environmental risks.
Formula:C7H10IN3O2
InChI:InChI=1S/C7H10IN3O2/c1-3-4-10-5(2)6(8)7(9-10)11(12)13/h3-4H2,1-2H3
InChI key:InChIKey=OWRXFSCZUDYNGX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(I)=C(C)N(CCC)N1
Synonyms:- 4-Iodo-5-methyl-3-nitro-1-propyl-1H-pyrazole
- 1H-Pyrazole, 4-iodo-5-methyl-3-nitro-1-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.