
CAS 1354705-45-5
:1-Ethyl-4-iodo-5-methyl-3-nitro-1H-pyrazole
Description:
1-Ethyl-4-iodo-5-methyl-3-nitro-1H-pyrazole is a heterocyclic organic compound characterized by its pyrazole ring, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group at the first position, an iodine atom at the fourth position, a methyl group at the fifth position, and a nitro group at the third position of the pyrazole ring. The presence of the iodine atom contributes to its potential reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can enhance biological activity or selectivity. Its molecular properties, such as solubility and melting point, would depend on the specific interactions of the functional groups present. Overall, 1-Ethyl-4-iodo-5-methyl-3-nitro-1H-pyrazole is a compound of interest in synthetic organic chemistry and related fields.
Formula:C6H8IN3O2
InChI:InChI=1S/C6H8IN3O2/c1-3-9-4(2)5(7)6(8-9)10(11)12/h3H2,1-2H3
InChI key:InChIKey=XRLBFWFNQSSWTJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(I)=C(C)N(CC)N1
Synonyms:- 1-Ethyl-4-iodo-5-methyl-3-nitro-1H-pyrazole
- 1H-Pyrazole, 1-ethyl-4-iodo-5-methyl-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.