CAS 1354705-49-9

4-Iodo-3-(methoxycarbonyl)-1H-pyrazole-1-acetic acid

Description:

4-Iodo-3-(methoxycarbonyl)-1H-pyrazole-1-acetic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of the iodo substituent at the 4-position enhances its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. The methoxycarbonyl group at the 3-position indicates the presence of an ester functional group, which can influence the compound's solubility and reactivity. Additionally, the acetic acid moiety contributes to its acidic properties, making it a potential candidate for various biological and chemical applications. This compound may exhibit interesting pharmacological activities due to its structural features, which can interact with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be utilized in research related to medicinal chemistry, agrochemicals, or material science. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₇H₇IN₂O₄

InChI: InChI=1S/C7H7IN2O4/c1-14-7(13)6-4(8)2-10(9-6)3-5(11)12/h2H,3H2,1H3,(H,11,12)

InChI key: InChIKey=YBXHTNNCGSTQKW-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(I)=CN(CC(O)=O)N1

Synonyms:

• 4-Iodo-3-(methoxycarbonyl)-1H-pyrazole-1-acetic acid
• 1H-Pyrazole-1-acetic acid, 4-iodo-3-(methoxycarbonyl)-

2-[4-Iodo-3-(methoxycarbonyl)-1H-pyrazol-1-yl]acetic acid

CAS: 1354705-49-9

Versatile small molecule scaffold

Formula: C₇H₇IN₂O₄

Purity: Min. 95%

Molecular weight: 310.05 g/mol

Ref: 3D-EEC70549