CymitQuimica logo

CAS 1354705-52-4

:

Methyl 3-cyclopropyl-4-iodo-1-methyl-1H-pyrazole-5-carboxylate

Description:
Methyl 3-cyclopropyl-4-iodo-1-methyl-1H-pyrazole-5-carboxylate is a chemical compound characterized by its unique pyrazole structure, which includes a cyclopropyl group and an iodine substituent. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the iodine atom may enhance its electrophilic properties, making it useful in various synthetic applications, including medicinal chemistry and agrochemical development. The methyl groups in the structure can influence its steric and electronic properties, affecting its interactions with biological targets. Additionally, the compound's molecular framework suggests potential applications in the development of pharmaceuticals, particularly in areas targeting specific biological pathways. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound exemplifies the complexity and diversity of organic molecules used in advanced chemical research.
Formula:C9H11IN2O2
InChI:InChI=1S/C9H11IN2O2/c1-12-8(9(13)14-2)6(10)7(11-12)5-3-4-5/h5H,3-4H2,1-2H3
InChI key:InChIKey=DHDJZUCHPDYQLR-UHFFFAOYSA-N
SMILES:IC=1C(=NN(C)C1C(OC)=O)C2CC2
Synonyms:
  • Methyl 3-cyclopropyl-4-iodo-1-methyl-1H-pyrazole-5-carboxylate
  • 1H-Pyrazole-5-carboxylic acid, 3-cyclopropyl-4-iodo-1-methyl-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.