CymitQuimica logo

CAS 1354705-60-4

:

1-Ethyl-4-iodo-3-(1-methylethyl)-1H-pyrazole

Description:
1-Ethyl-4-iodo-3-(1-methylethyl)-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of an ethyl group and an isopropyl group at specific positions on the pyrazole ring contributes to its unique structural and chemical properties. The iodine substituent at the 4-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit interesting biological activities, which can be attributed to the functional groups present in its structure. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. As with many halogenated compounds, it is essential to consider safety and handling precautions due to potential toxicity and environmental impact. Overall, 1-Ethyl-4-iodo-3-(1-methylethyl)-1H-pyrazole represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C8H13IN2
InChI:InChI=1S/C8H13IN2/c1-4-11-5-7(9)8(10-11)6(2)3/h5-6H,4H2,1-3H3
InChI key:InChIKey=SMZHPKIXWIYEST-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C(I)=CN(CC)N1
Synonyms:
  • 1-Ethyl-4-iodo-3-(1-methylethyl)-1H-pyrazole
  • 1H-Pyrazole, 1-ethyl-4-iodo-3-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.