
CAS 1354705-64-8
:3-Amino-4-iodo-N,N-dimethyl-1H-pyrazole-1-acetamide
Description:
3-Amino-4-iodo-N,N-dimethyl-1H-pyrazole-1-acetamide is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group and an iodo substituent at specific positions on the pyrazole ring, contributing to its reactivity and potential biological activity. The presence of the N,N-dimethyl group indicates that the compound has two methyl groups attached to the nitrogen atom, which can influence its solubility and steric properties. The acetamide functional group enhances its potential for hydrogen bonding, affecting its interactions in biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its unique structure allows for potential applications in drug development, particularly in targeting specific biological pathways. As with many chemical substances, safety and handling precautions should be observed, given the presence of iodine, which can be hazardous.
Formula:C7H11IN4O
InChI:InChI=1S/C7H11IN4O/c1-11(2)6(13)4-12-3-5(8)7(9)10-12/h3H,4H2,1-2H3,(H2,9,10)
InChI key:InChIKey=QHYISUFFQYLJJD-UHFFFAOYSA-N
SMILES:C(C(N(C)C)=O)N1C=C(I)C(N)=N1
Synonyms:- 3-Amino-4-iodo-N,N-dimethyl-1H-pyrazole-1-acetamide
- 1H-Pyrazole-1-acetamide, 3-amino-4-iodo-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.