CAS 1354705-75-1

3-Amino-4-iodo-1H-pyrazole-1-acetic acid

Description:

3-Amino-4-iodo-1H-pyrazole-1-acetic acid is a heterocyclic organic compound characterized by the presence of a pyrazole ring, an amino group, and an acetic acid moiety. The compound features an iodine atom at the 4-position of the pyrazole ring, which can influence its reactivity and biological activity. The amino group at the 3-position contributes to its potential as a building block in medicinal chemistry, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The acetic acid functional group enhances the compound's solubility in polar solvents and may also play a role in its interaction with biological targets. This compound is of interest in pharmaceutical research due to its potential applications in drug development, particularly in the fields of anti-inflammatory and antimicrobial agents. Its unique structural features make it a candidate for further studies to explore its pharmacological properties and mechanisms of action.

Formula: C₅H₆IN₃O₂

InChI: InChI=1S/C5H6IN3O2/c6-3-1-9(2-4(10)11)8-5(3)7/h1H,2H2,(H2,7,8)(H,10,11)

InChI key: InChIKey=QXGSREWHCSJEGQ-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=C(I)C(N)=N1

Synonyms:

• 1H-Pyrazole-1-acetic acid, 3-amino-4-iodo-
• 3-Amino-4-iodo-1H-pyrazole-1-acetic acid